C20H40O3Si2 — CID 11257625
2-[(1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-triethylsilyloxycyclohex-2-en-1-yl]acetaldehyde (PubChem CID 11257625) has the molecular formula C20H40O3Si2 and a molecular weight of 384.71 g/mol. Its IUPAC name is 2-[(1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-triethylsilyloxycyclohex-2-en-1-yl]acetaldehyde.
| Compound Name | 2-[(1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-triethylsilyloxycyclohex-2-en-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 11257625 |
| Molecular Formula | C20H40O3Si2 |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2-[(1S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-triethylsilyloxycyclohex-2-en-1-yl]acetaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@@]1(CC=O)C=CCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O3Si2/c1-9-25(10-2,11-3)23-20(16-17-21)15-13-12-14-18(20)22-24(7,8)19(4,5)6/h13,15,17-18H,9-12,14,16H2,1-8H3/t18-,20+/m0/s1 |
| InChIKey | JYLPGQPRNNNMAW-AZUAARDMSA-N |
| XLogP | 6.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|