C21H44O3Si2 — CID 11069425
(3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylhept-6-enal (PubChem CID 11069425) has the molecular formula C21H44O3Si2 and a molecular weight of 400.75 g/mol. Its IUPAC name is (3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylhept-6-enal.
| Compound Name | (3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylhept-6-enal |
|---|---|
| PubChem CID | 11069425 |
| Molecular Formula | C21H44O3Si2 |
| Molecular Weight | 400.75 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylhept-6-enal |
| SMILES | C=C(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O3Si2/c1-16(2)19(24-26(12,13)21(7,8)9)17(3)18(14-15-22)23-25(10,11)20(4,5)6/h15,17-19H,1,14H2,2-13H3/t17-,18-,19-/m0/s1 |
| InChIKey | HVUZRUDSQJDENA-FHWLQOOXSA-N |
| XLogP | 6.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.75 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|