C25H52O3Si2 — CID 10599914
(2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enal (PubChem CID 10599914) has the molecular formula C25H52O3Si2 and a molecular weight of 456.86 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enal.
| Compound Name | (2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enal |
|---|---|
| PubChem CID | 10599914 |
| Molecular Formula | C25H52O3Si2 |
| Molecular Weight | 456.86 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | (2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enal |
| SMILES | C=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C(C)C=O |
| InChI | InChI=1S/C25H52O3Si2/c1-15-16-23(27-29(13,14)25(10,11)12)22(9)24(21(8)17-26)28-30(18(2)3,19(4)5)20(6)7/h15,17-24H,1,16H2,2-14H3/t21?,22-,23-,24+/m1/s1 |
| InChIKey | YDNQURYDIRLFBT-UUOMVCFKSA-N |
| XLogP | 7.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.86 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|