C33H68O3Si3 — CID 71489866
(5S,7S,8E,10R,11S,12E)-11-[tert-butyl(dimethyl)silyl]oxy-7,10-dimethyl-13-trimethylsilyl-5-tri(propan-2-yl)silyloxytrideca-8,12-dienal (PubChem CID 71489866) has the molecular formula C33H68O3Si3 and a molecular weight of 597.16 g/mol. Its IUPAC name is (5S,7S,8E,10R,11S,12E)-11-[tert-butyl(dimethyl)silyl]oxy-7,10-dimethyl-13-trimethylsilyl-5-tri(propan-2-yl)silyloxytrideca-8,12-dienal.
| Compound Name | (5S,7S,8E,10R,11S,12E)-11-[tert-butyl(dimethyl)silyl]oxy-7,10-dimethyl-13-trimethylsilyl-5-tri(propan-2-yl)silyloxytrideca-8,12-dienal |
|---|---|
| PubChem CID | 71489866 |
| Molecular Formula | C33H68O3Si3 |
| Molecular Weight | 597.16 g/mol |
| Exact Mass | 596.45 |
| IUPAC Name | (5S,7S,8E,10R,11S,12E)-11-[tert-butyl(dimethyl)silyl]oxy-7,10-dimethyl-13-trimethylsilyl-5-tri(propan-2-yl)silyloxytrideca-8,12-dienal |
| SMILES | CC(C)[Si](O[C@@H](CCCC=O)C[C@H](C)/C=C/[C@@H](C)[C@@H](/C=C/[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H68O3Si3/c1-26(2)39(27(3)4,28(5)6)35-31(19-17-18-23-34)25-29(7)20-21-30(8)32(22-24-37(12,13)14)36-38(15,16)33(9,10)11/h20-24,26-32H,17-19,25H2,1-16H3/b21-20+,24-22+/t29-,30-,31+,32-/m1/s1 |
| InChIKey | QZMUBQNRSNPBTP-WTMUYEBPSA-N |
| XLogP | 10.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.16 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|