C30H62O4Si3 — CID 135019578
(3R,4S,5E,9S,11R)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-9-trimethylsilyloxytetradeca-5,13-dien-7-one (PubChem CID 135019578) has the molecular formula C30H62O4Si3 and a molecular weight of 571.08 g/mol. Its IUPAC name is (3R,4S,5E,9S,11R)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-9-trimethylsilyloxytetradeca-5,13-dien-7-one.
| Compound Name | (3R,4S,5E,9S,11R)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-9-trimethylsilyloxytetradeca-5,13-dien-7-one |
|---|---|
| PubChem CID | 135019578 |
| Molecular Formula | C30H62O4Si3 |
| Molecular Weight | 571.08 g/mol |
| Exact Mass | 570.40 |
| IUPAC Name | (3R,4S,5E,9S,11R)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-9-trimethylsilyloxytetradeca-5,13-dien-7-one |
| SMILES | C=CC[C@H](C[C@@H](CC(=O)/C=C/[C@H](C)[C@@H](CC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H62O4Si3/c1-17-19-26(33-36(13,14)29(4,5)6)23-27(32-35(10,11)12)22-25(31)21-20-24(3)28(18-2)34-37(15,16)30(7,8)9/h17,20-21,24,26-28H,1,18-19,22-23H2,2-16H3/b21-20+/t24-,26+,27+,28+/m0/s1 |
| InChIKey | NZHSVXUPYWRFAK-YLISSQIFSA-N |
| XLogP | 9.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.08 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|