C29H60O3Si2 — CID 11113969
(E,7S,8S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,7-trimethyltetradec-4-en-6-one (PubChem CID 11113969) has the molecular formula C29H60O3Si2 and a molecular weight of 512.97 g/mol. Its IUPAC name is (E,7S,8S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,7-trimethyltetradec-4-en-6-one.
| Compound Name | (E,7S,8S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,7-trimethyltetradec-4-en-6-one |
|---|---|
| PubChem CID | 11113969 |
| Molecular Formula | C29H60O3Si2 |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 512.41 |
| IUPAC Name | (E,7S,8S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,7-trimethyltetradec-4-en-6-one |
| SMILES | C/C(=C\CC(C)C)C(=O)[C@@H](C)[C@H](CCCCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H60O3Si2/c1-23(2)20-21-24(3)27(30)25(4)26(32-34(13,14)29(8,9)10)19-17-15-16-18-22-31-33(11,12)28(5,6)7/h21,23,25-26H,15-20,22H2,1-14H3/b24-21+/t25-,26-/m0/s1 |
| InChIKey | CEPIABNHGDNMHS-MAYDELSXSA-N |
| XLogP | 9.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|