C26H52O4Si2 — CID 71530896
(E,3S)-10-[tert-butyl(dimethyl)silyl]oxy-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyl-5-oxodec-6-enal (PubChem CID 71530896) has the molecular formula C26H52O4Si2 and a molecular weight of 484.87 g/mol. Its IUPAC name is (E,3S)-10-[tert-butyl(dimethyl)silyl]oxy-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyl-5-oxodec-6-enal.
| Compound Name | (E,3S)-10-[tert-butyl(dimethyl)silyl]oxy-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyl-5-oxodec-6-enal |
|---|---|
| PubChem CID | 71530896 |
| Molecular Formula | C26H52O4Si2 |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | (E,3S)-10-[tert-butyl(dimethyl)silyl]oxy-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methyl-5-oxodec-6-enal |
| SMILES | C[C@@H](CC=O)CC(=O)/C(=C/CCCO[Si](C)(C)C(C)(C)C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O4Si2/c1-22(17-18-27)21-24(28)23(16-14-20-30-32(10,11)26(5,6)7)15-12-13-19-29-31(8,9)25(2,3)4/h15,18,22H,12-14,16-17,19-21H2,1-11H3/b23-15+/t22-/m0/s1 |
| InChIKey | BMRWEDFCSBYYLZ-GQBVICOWSA-N |
| XLogP | 7.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|