C21H42O3Si2 — CID 10408600
(4R,5S,6S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-one (PubChem CID 10408600) has the molecular formula C21H42O3Si2 and a molecular weight of 398.74 g/mol. Its IUPAC name is (4R,5S,6S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-one.
| Compound Name | (4R,5S,6S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-one |
|---|---|
| PubChem CID | 10408600 |
| Molecular Formula | C21H42O3Si2 |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (4R,5S,6S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C=CC(=O)[C@H]1C |
| InChI | InChI=1S/C21H42O3Si2/c1-11-26(12-2,13-3)24-20-16(4)18(22)14-15-19(17(20)5)23-25(9,10)21(6,7)8/h14-17,19-20H,11-13H2,1-10H3/t16-,17+,19-,20-/m1/s1 |
| InChIKey | MTMQVLGTAPAYFA-PIKOESSRSA-N |
| XLogP | 6.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|