C15H28O3Si — CID 10062448
(4R,5S,6S,7S)-4-hydroxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-one (PubChem CID 10062448) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is (4R,5S,6S,7S)-4-hydroxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-one.
| Compound Name | (4R,5S,6S,7S)-4-hydroxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-one |
|---|---|
| PubChem CID | 10062448 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (4R,5S,6S,7S)-4-hydroxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@H](O)C=CC(=O)[C@H]1C |
| InChI | InChI=1S/C15H28O3Si/c1-6-19(7-2,8-3)18-15-11(4)13(16)9-10-14(17)12(15)5/h9-13,15-16H,6-8H2,1-5H3/t11-,12+,13+,15-/m0/s1 |
| InChIKey | ABNZTRWJQHMUDR-JLNYLFASSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|