C19H36O3Si — CID 11067794
1-[(4R,5S,6R)-2,2-ditert-butyl-5-methyl-6-[(E)-prop-1-enyl]-1,3,2-dioxasilinan-4-yl]butan-2-one (PubChem CID 11067794) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is 1-[(4R,5S,6R)-2,2-ditert-butyl-5-methyl-6-[(E)-prop-1-enyl]-1,3,2-dioxasilinan-4-yl]butan-2-one.
| Compound Name | 1-[(4R,5S,6R)-2,2-ditert-butyl-5-methyl-6-[(E)-prop-1-enyl]-1,3,2-dioxasilinan-4-yl]butan-2-one |
|---|---|
| PubChem CID | 11067794 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 1-[(4R,5S,6R)-2,2-ditert-butyl-5-methyl-6-[(E)-prop-1-enyl]-1,3,2-dioxasilinan-4-yl]butan-2-one |
| SMILES | C/C=C/[C@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@H](CC(=O)CC)[C@@H]1C |
| InChI | InChI=1S/C19H36O3Si/c1-10-12-16-14(3)17(13-15(20)11-2)22-23(21-16,18(4,5)6)19(7,8)9/h10,12,14,16-17H,11,13H2,1-9H3/b12-10+/t14-,16-,17-/m1/s1 |
| InChIKey | WAFPBJWFKAHWPP-OHVBZBGNSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|