C23H44O2Si2 — CID 11101623
2-[(E,1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one (PubChem CID 11101623) has the molecular formula C23H44O2Si2 and a molecular weight of 408.78 g/mol. Its IUPAC name is 2-[(E,1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one.
| Compound Name | 2-[(E,1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11101623 |
| Molecular Formula | C23H44O2Si2 |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 2-[(E,1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethyl-6-trimethylsilylhex-4-enyl]cyclohex-2-en-1-one |
| SMILES | C/C(=C\C[Si](C)(C)C)[C@H](C)C[C@H](O[Si](C)(C)C(C)(C)C)C1=CCCCC1=O |
| InChI | InChI=1S/C23H44O2Si2/c1-18(15-16-26(6,7)8)19(2)17-22(20-13-11-12-14-21(20)24)25-27(9,10)23(3,4)5/h13,15,19,22H,11-12,14,16-17H2,1-10H3/b18-15+/t19-,22+/m1/s1 |
| InChIKey | VGGIXWKFUJADIA-MPEHWXSUSA-N |
| XLogP | 7.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|