C19H38O3Si2 — CID 14263274
(4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohept-2-en-1-one (PubChem CID 14263274) has the molecular formula C19H38O3Si2 and a molecular weight of 370.68 g/mol. Its IUPAC name is (4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohept-2-en-1-one.
| Compound Name | (4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohept-2-en-1-one |
|---|---|
| PubChem CID | 14263274 |
| Molecular Formula | C19H38O3Si2 |
| Molecular Weight | 370.68 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohept-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(=O)C=C[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H38O3Si2/c1-18(2,3)23(7,8)21-16-12-11-15(20)13-17(14-16)22-24(9,10)19(4,5)6/h11-12,16-17H,13-14H2,1-10H3/t16-,17+/m0/s1 |
| InChIKey | QLQZOEJPYSNVKK-DLBZAZTESA-N |
| XLogP | 5.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|