C25H46O4Si2 — CID 70405695
2-[1-[diethyl-[(Z)-7-oxooct-3-enoxy]silyl]ethyl]-4-triethylsilyloxycyclopent-2-en-1-one (PubChem CID 70405695) has the molecular formula C25H46O4Si2 and a molecular weight of 466.81 g/mol. Its IUPAC name is 2-[1-[diethyl-[(Z)-7-oxooct-3-enoxy]silyl]ethyl]-4-triethylsilyloxycyclopent-2-en-1-one.
| Compound Name | 2-[1-[diethyl-[(Z)-7-oxooct-3-enoxy]silyl]ethyl]-4-triethylsilyloxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 70405695 |
| Molecular Formula | C25H46O4Si2 |
| Molecular Weight | 466.81 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 2-[1-[diethyl-[(Z)-7-oxooct-3-enoxy]silyl]ethyl]-4-triethylsilyloxycyclopent-2-en-1-one |
| SMILES | CC[Si](CC)(CC)OC1C=C(C(C)[Si](CC)(CC)OCC/C=C\CCC(C)=O)C(=O)C1 |
| InChI | InChI=1S/C25H46O4Si2/c1-8-30(9-2,10-3)29-23-19-24(25(27)20-23)22(7)31(11-4,12-5)28-18-16-14-13-15-17-21(6)26/h13-14,19,22-23H,8-12,15-18,20H2,1-7H3/b14-13- |
| InChIKey | OWFTUZXJUIDPQR-YPKPFQOOSA-N |
| XLogP | 6.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.81 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|