C23H44O5Si — CID 23253339
(E,2R,3S,4S,6R,10R,11R)-3-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-2,4,6,10-tetramethyl-7-oxotridec-8-enoic acid (PubChem CID 23253339) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is (E,2R,3S,4S,6R,10R,11R)-3-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-2,4,6,10-tetramethyl-7-oxotridec-8-enoic acid.
| Compound Name | (E,2R,3S,4S,6R,10R,11R)-3-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-2,4,6,10-tetramethyl-7-oxotridec-8-enoic acid |
|---|---|
| PubChem CID | 23253339 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | (E,2R,3S,4S,6R,10R,11R)-3-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-2,4,6,10-tetramethyl-7-oxotridec-8-enoic acid |
| SMILES | CC[C@@H](O)[C@H](C)/C=C/C(=O)[C@H](C)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C23H44O5Si/c1-11-19(24)15(2)12-13-20(25)16(3)14-17(4)21(18(5)22(26)27)28-29(9,10)23(6,7)8/h12-13,15-19,21,24H,11,14H2,1-10H3,(H,26,27)/b13-12+/t15-,16-,17+,18-,19-,21+/m1/s1 |
| InChIKey | ZYSOTWRBMUQZRE-RFLJKRQHSA-N |
| XLogP | 5.29 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|