C17H28O5 — CID 162868154
(3S,4R,5S,7R,9E,11S,12S)-4-hydroxy-12-[(1S)-1-hydroxyethyl]-3,5,7,11-tetramethyl-1-oxacyclododec-9-ene-2,8-dione (PubChem CID 162868154) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3S,4R,5S,7R,9E,11S,12S)-4-hydroxy-12-[(1S)-1-hydroxyethyl]-3,5,7,11-tetramethyl-1-oxacyclododec-9-ene-2,8-dione.
| Compound Name | (3S,4R,5S,7R,9E,11S,12S)-4-hydroxy-12-[(1S)-1-hydroxyethyl]-3,5,7,11-tetramethyl-1-oxacyclododec-9-ene-2,8-dione |
|---|---|
| PubChem CID | 162868154 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (3S,4R,5S,7R,9E,11S,12S)-4-hydroxy-12-[(1S)-1-hydroxyethyl]-3,5,7,11-tetramethyl-1-oxacyclododec-9-ene-2,8-dione |
| SMILES | C[C@@H]1C[C@H](C)[C@@H](O)[C@H](C)C(=O)O[C@H]([C@H](C)O)[C@@H](C)/C=C/C1=O |
| InChI | InChI=1S/C17H28O5/c1-9-6-7-14(19)10(2)8-11(3)15(20)12(4)17(21)22-16(9)13(5)18/h6-7,9-13,15-16,18,20H,8H2,1-5H3/b7-6+/t9-,10+,11-,12-,13-,15+,16-/m0/s1 |
| InChIKey | BZXWGQHZMYPAJO-DBVQFRNPSA-N |
| XLogP | 1.71 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |