C22H44O3Si2 — CID 11122507
(4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-one (PubChem CID 11122507) has the molecular formula C22H44O3Si2 and a molecular weight of 412.76 g/mol. Its IUPAC name is (4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-one.
| Compound Name | (4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-one |
|---|---|
| PubChem CID | 11122507 |
| Molecular Formula | C22H44O3Si2 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-tri(propan-2-yl)silyloxycyclohept-2-en-1-one |
| SMILES | CC(C)[Si](O[C@H]1CC(=O)C=C[C@@H](O[Si](C)(C)C(C)(C)C)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H44O3Si2/c1-16(2)27(17(3)4,18(5)6)25-21-14-19(23)12-13-20(15-21)24-26(10,11)22(7,8)9/h12-13,16-18,20-21H,14-15H2,1-11H3/t20-,21+/m1/s1 |
| InChIKey | DNIJSLSAGWLZJJ-RTWAWAEBSA-N |
| XLogP | 6.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|