C39H80O4Si3 — CID 71762601
(2R,3R,4S,6S,9R,10S,11S,12S,13Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6,10,12-pentamethyl-11-trimethylsilyloxy-9-tri(propan-2-yl)silyloxyhexadeca-13,15-dienal (PubChem CID 71762601) has the molecular formula C39H80O4Si3 and a molecular weight of 697.32 g/mol. Its IUPAC name is (2R,3R,4S,6S,9R,10S,11S,12S,13Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6,10,12-pentamethyl-11-trimethylsilyloxy-9-tri(propan-2-yl)silyloxyhexadeca-13,15-dienal.
| Compound Name | (2R,3R,4S,6S,9R,10S,11S,12S,13Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6,10,12-pentamethyl-11-trimethylsilyloxy-9-tri(propan-2-yl)silyloxyhexadeca-13,15-dienal |
|---|---|
| PubChem CID | 71762601 |
| Molecular Formula | C39H80O4Si3 |
| Molecular Weight | 697.32 g/mol |
| Exact Mass | 696.54 |
| IUPAC Name | (2R,3R,4S,6S,9R,10S,11S,12S,13Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6,10,12-pentamethyl-11-trimethylsilyloxy-9-tri(propan-2-yl)silyloxyhexadeca-13,15-dienal |
| SMILES | C=C/C=C\[C@H](C)[C@H](O[Si](C)(C)C)[C@@H](C)[C@@H](CC[C@H](C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C39H80O4Si3/c1-21-22-23-32(9)38(42-44(16,17)18)35(12)36(41-46(28(2)3,29(4)5)30(6)7)25-24-31(8)26-33(10)37(34(11)27-40)43-45(19,20)39(13,14)15/h21-23,27-38H,1,24-26H2,2-20H3/b23-22-/t31-,32-,33-,34-,35-,36+,37+,38-/m0/s1 |
| InChIKey | POPAFRPIOGGETO-XZSCTPHBSA-N |
| XLogP | 12.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.32 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|