C20H30O4 — CID 23524034
7-(6-but-2-ynyl-3,6-dihydro-2H-pyran-2-yl)-2-(methoxymethoxy)-6-methyl-4-methylideneheptanal (PubChem CID 23524034) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 7-(6-but-2-ynyl-3,6-dihydro-2H-pyran-2-yl)-2-(methoxymethoxy)-6-methyl-4-methylideneheptanal.
| Compound Name | 7-(6-but-2-ynyl-3,6-dihydro-2H-pyran-2-yl)-2-(methoxymethoxy)-6-methyl-4-methylideneheptanal |
|---|---|
| PubChem CID | 23524034 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 7-(6-but-2-ynyl-3,6-dihydro-2H-pyran-2-yl)-2-(methoxymethoxy)-6-methyl-4-methylideneheptanal |
| SMILES | C=C(CC(C)CC1CC=CC(CC#CC)O1)CC(C=O)OCOC |
| InChI | InChI=1S/C20H30O4/c1-5-6-8-18-9-7-10-19(24-18)12-16(2)11-17(3)13-20(14-21)23-15-22-4/h7,9,14,16,18-20H,3,8,10-13,15H2,1-2,4H3 |
| InChIKey | WBEJKWYBCHHFLZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|