C21H36O3Si — CID 11152744
(2S)-2-[(1R,5S)-1,8-dimethylspiro[4.5]deca-3,8-dien-4-yl]-2-(2-trimethylsilylethoxymethoxy)propanal (PubChem CID 11152744) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (2S)-2-[(1R,5S)-1,8-dimethylspiro[4.5]deca-3,8-dien-4-yl]-2-(2-trimethylsilylethoxymethoxy)propanal.
| Compound Name | (2S)-2-[(1R,5S)-1,8-dimethylspiro[4.5]deca-3,8-dien-4-yl]-2-(2-trimethylsilylethoxymethoxy)propanal |
|---|---|
| PubChem CID | 11152744 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (2S)-2-[(1R,5S)-1,8-dimethylspiro[4.5]deca-3,8-dien-4-yl]-2-(2-trimethylsilylethoxymethoxy)propanal |
| SMILES | CC1=CC[C@]2(CC1)C([C@@](C)(C=O)OCOCC[Si](C)(C)C)=CC[C@H]2C |
| InChI | InChI=1S/C21H36O3Si/c1-17-9-11-21(12-10-17)18(2)7-8-19(21)20(3,15-22)24-16-23-13-14-25(4,5)6/h8-9,15,18H,7,10-14,16H2,1-6H3/t18-,20-,21-/m1/s1 |
| InChIKey | BJNXIPGHYHCCNQ-HMXCVIKNSA-N |
| XLogP | 5.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|