C26H44O4Si — CID 10961339
(1R,4R,5R,9R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-dien-2-one (PubChem CID 10961339) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is (1R,4R,5R,9R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-dien-2-one.
| Compound Name | (1R,4R,5R,9R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-dien-2-one |
|---|---|
| PubChem CID | 10961339 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (1R,4R,5R,9R,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-dien-2-one |
| SMILES | CO[C@]12C=C[C@](C)(O1)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(C)=CC[C@H](C(C)C)[C@H]1CC2=O |
| InChI | InChI=1S/C26H44O4Si/c1-17(2)19-12-11-18(3)20-16-23(29-31(9,10)24(4,5)6)25(7)13-14-26(28-8,30-25)22(27)15-21(19)20/h11,13-14,17,19-21,23H,12,15-16H2,1-10H3/t19-,20+,21-,23+,25+,26-/m1/s1 |
| InChIKey | VGWSFTINYLLXEG-CQXXXZSISA-N |
| XLogP | 6.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|