C30H40N2O5 — CID 10791765
[(1S,2S,4R,8R,9S,10Z,12R)-11-(acetamidomethyl)-12-methoxy-1,5-dimethyl-8-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-5,10,13-trien-2-yl] N-phenylcarbamate (PubChem CID 10791765) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is [(1S,2S,4R,8R,9S,10Z,12R)-11-(acetamidomethyl)-12-methoxy-1,5-dimethyl-8-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-5,10,13-trien-2-yl] N-phenylcarbamate.
| Compound Name | [(1S,2S,4R,8R,9S,10Z,12R)-11-(acetamidomethyl)-12-methoxy-1,5-dimethyl-8-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-5,10,13-trien-2-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 10791765 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | [(1S,2S,4R,8R,9S,10Z,12R)-11-(acetamidomethyl)-12-methoxy-1,5-dimethyl-8-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-5,10,13-trien-2-yl] N-phenylcarbamate |
| SMILES | CO[C@]12C=C[C@](C)(O1)[C@@H](OC(=O)Nc1ccccc1)C[C@H]1C(C)=CC[C@H](C(C)C)[C@H]1/C=C\2CNC(C)=O |
| InChI | InChI=1S/C30H40N2O5/c1-19(2)24-13-12-20(3)25-17-27(36-28(34)32-23-10-8-7-9-11-23)29(5)14-15-30(35-6,37-29)22(16-26(24)25)18-31-21(4)33/h7-12,14-16,19,24-27H,13,17-18H2,1-6H3,(H,31,33)(H,32,34)/b22-16-/t24-,25+,26-,27+,29+,30-/m1/s1 |
| InChIKey | QWCCCQUKORHANX-HKASVQARSA-N |
| XLogP | 5.61 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|