C25H40O5 — CID 11112605
[(1R,2R,4R,5R,9R,11S,12S)-11-hydroxy-1-methoxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-dien-2-yl] 2,2-dimethylpropanoate (PubChem CID 11112605) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is [(1R,2R,4R,5R,9R,11S,12S)-11-hydroxy-1-methoxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-dien-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,2R,4R,5R,9R,11S,12S)-11-hydroxy-1-methoxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-dien-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11112605 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | [(1R,2R,4R,5R,9R,11S,12S)-11-hydroxy-1-methoxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-dien-2-yl] 2,2-dimethylpropanoate |
| SMILES | CO[C@]12C=C[C@](C)(O1)[C@@H](O)C[C@H]1C(C)=CC[C@H](C(C)C)[C@H]1C[C@H]2OC(=O)C(C)(C)C |
| InChI | InChI=1S/C25H40O5/c1-15(2)17-10-9-16(3)18-13-20(26)24(7)11-12-25(28-8,30-24)21(14-19(17)18)29-22(27)23(4,5)6/h9,11-12,15,17-21,26H,10,13-14H2,1-8H3/t17-,18+,19-,20+,21-,24+,25-/m1/s1 |
| InChIKey | IIQUIRZYDCJFIM-JZVUSVNDSA-N |
| XLogP | 4.64 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|