C21H30O5 — CID 101394768
[(1R,4aR,6S,8Z,11R,12aR)-6-methoxy-4-methyl-7,10-dioxo-1-propan-2-yl-1,2,4a,5,6,11,12,12a-octahydrobenzo[10]annulen-11-yl] acetate (PubChem CID 101394768) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(1R,4aR,6S,8Z,11R,12aR)-6-methoxy-4-methyl-7,10-dioxo-1-propan-2-yl-1,2,4a,5,6,11,12,12a-octahydrobenzo[10]annulen-11-yl] acetate.
| Compound Name | [(1R,4aR,6S,8Z,11R,12aR)-6-methoxy-4-methyl-7,10-dioxo-1-propan-2-yl-1,2,4a,5,6,11,12,12a-octahydrobenzo[10]annulen-11-yl] acetate |
|---|---|
| PubChem CID | 101394768 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(1R,4aR,6S,8Z,11R,12aR)-6-methoxy-4-methyl-7,10-dioxo-1-propan-2-yl-1,2,4a,5,6,11,12,12a-octahydrobenzo[10]annulen-11-yl] acetate |
| SMILES | CO[C@H]1C[C@H]2C(C)=CC[C@H](C(C)C)[C@H]2C[C@@H](OC(C)=O)C(=O)/C=C\C1=O |
| InChI | InChI=1S/C21H30O5/c1-12(2)15-7-6-13(3)16-10-20(25-5)18(23)8-9-19(24)21(11-17(15)16)26-14(4)22/h6,8-9,12,15-17,20-21H,7,10-11H2,1-5H3/b9-8-/t15-,16+,17-,20+,21-/m1/s1 |
| InChIKey | BZXYMBJXGHQNRX-GIMUVEDHSA-N |
| XLogP | 3.28 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|