C22H32O6 — CID 91157353
[(3aS,5R)-5-acetyloxy-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] 2-methylbutanoate (PubChem CID 91157353) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is [(3aS,5R)-5-acetyloxy-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] 2-methylbutanoate.
| Compound Name | [(3aS,5R)-5-acetyloxy-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 91157353 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [(3aS,5R)-5-acetyloxy-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC=C(C)[C@H](OC(C)=O)C[C@@H]2C(C=C1C)OC(=O)C2C |
| InChI | InChI=1S/C22H32O6/c1-7-12(2)21(24)27-18-9-8-13(3)19(26-16(6)23)11-17-15(5)22(25)28-20(17)10-14(18)4/h8,10,12,15,17-20H,7,9,11H2,1-6H3/t12?,15?,17-,18?,19+,20?/m0/s1 |
| InChIKey | IYRJPPPAGLOZDS-VMXNBTMESA-N |
| XLogP | 3.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|