C20H30O4 — CID 91524510
[(3aS)-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] 2-methylbutanoate (PubChem CID 91524510) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is [(3aS)-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] 2-methylbutanoate.
| Compound Name | [(3aS)-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 91524510 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | [(3aS)-3,6,10-trimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-9-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC=C(C)CC[C@@H]2C(C=C1C)OC(=O)C2C |
| InChI | InChI=1S/C20H30O4/c1-6-13(3)19(21)23-17-10-8-12(2)7-9-16-15(5)20(22)24-18(16)11-14(17)4/h8,11,13,15-18H,6-7,9-10H2,1-5H3/t13?,15?,16-,17?,18?/m0/s1 |
| InChIKey | JMRFSMRCASRCOV-WUOHCBFZSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|