C21H30O4 — CID 101345065
[(1S,2R,3R,7R,8S,11S)-6-methyl-10-methylidene-14-oxo-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate (PubChem CID 101345065) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is [(1S,2R,3R,7R,8S,11S)-6-methyl-10-methylidene-14-oxo-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate.
| Compound Name | [(1S,2R,3R,7R,8S,11S)-6-methyl-10-methylidene-14-oxo-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate |
|---|---|
| PubChem CID | 101345065 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [(1S,2R,3R,7R,8S,11S)-6-methyl-10-methylidene-14-oxo-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate |
| SMILES | C=C1C[C@@H]2O[C@H](C(=O)CC[C@@H]1OC(C)=O)[C@H]1[C@@H]2C(C)=CC[C@@H]1C(C)C |
| InChI | InChI=1S/C21H30O4/c1-11(2)15-7-6-12(3)19-18-10-13(4)17(24-14(5)22)9-8-16(23)21(25-18)20(15)19/h6,11,15,17-21H,4,7-10H2,1-3,5H3/t15-,17+,18+,19-,20-,21-/m1/s1 |
| InChIKey | VCQKXYFOVXJRSF-UDBQEWARSA-N |
| XLogP | 3.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|