C22H34O2 — CID 23252104
[(4E,8E,10E)-4,8-dimethyl-14-methylidene-11-propan-2-ylcyclotetradeca-4,8,10-trien-1-yl] acetate (PubChem CID 23252104) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is [(4E,8E,10E)-4,8-dimethyl-14-methylidene-11-propan-2-ylcyclotetradeca-4,8,10-trien-1-yl] acetate.
| Compound Name | [(4E,8E,10E)-4,8-dimethyl-14-methylidene-11-propan-2-ylcyclotetradeca-4,8,10-trien-1-yl] acetate |
|---|---|
| PubChem CID | 23252104 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | [(4E,8E,10E)-4,8-dimethyl-14-methylidene-11-propan-2-ylcyclotetradeca-4,8,10-trien-1-yl] acetate |
| SMILES | C=C1CC/C(C(C)C)=C\C=C(/C)CC/C=C(\C)CCC1OC(C)=O |
| InChI | InChI=1S/C22H34O2/c1-16(2)21-13-10-17(3)8-7-9-18(4)11-15-22(24-20(6)23)19(5)12-14-21/h9-10,13,16,22H,5,7-8,11-12,14-15H2,1-4,6H3/b17-10+,18-9+,21-13+ |
| InChIKey | ZLJVICOBUWLZNP-JDXXUPDUSA-N |
| XLogP | 6.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|