C22H32O3 — CID 162918348
[(1S,3aR,9S,12aS)-3a,6-dimethyl-10-methylidene-3-oxo-1-prop-1-en-2-yl-2,4,7,8,9,11,12,12a-octahydro-1H-cyclopenta[11]annulen-9-yl] acetate (PubChem CID 162918348) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(1S,3aR,9S,12aS)-3a,6-dimethyl-10-methylidene-3-oxo-1-prop-1-en-2-yl-2,4,7,8,9,11,12,12a-octahydro-1H-cyclopenta[11]annulen-9-yl] acetate.
| Compound Name | [(1S,3aR,9S,12aS)-3a,6-dimethyl-10-methylidene-3-oxo-1-prop-1-en-2-yl-2,4,7,8,9,11,12,12a-octahydro-1H-cyclopenta[11]annulen-9-yl] acetate |
|---|---|
| PubChem CID | 162918348 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(1S,3aR,9S,12aS)-3a,6-dimethyl-10-methylidene-3-oxo-1-prop-1-en-2-yl-2,4,7,8,9,11,12,12a-octahydro-1H-cyclopenta[11]annulen-9-yl] acetate |
| SMILES | C=C1CC[C@H]2[C@@H](C(=C)C)CC(=O)[C@]2(C)CC=C(C)CC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H32O3/c1-14(2)18-13-21(24)22(6)12-11-15(3)7-10-20(25-17(5)23)16(4)8-9-19(18)22/h11,18-20H,1,4,7-10,12-13H2,2-3,5-6H3/t18-,19+,20+,22-/m1/s1 |
| InChIKey | LEKTXKLLRZYNPF-FCIYXJNOSA-N |
| XLogP | 5.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|