C22H32O3 — CID 70675884
[(3S,3aS,6E,9R,10E,12aR)-6,10,12a-trimethyl-1-oxo-3-prop-1-en-2-yl-2,3,3a,4,5,8,9,12-octahydrocyclopenta[11]annulen-9-yl] acetate (PubChem CID 70675884) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(3S,3aS,6E,9R,10E,12aR)-6,10,12a-trimethyl-1-oxo-3-prop-1-en-2-yl-2,3,3a,4,5,8,9,12-octahydrocyclopenta[11]annulen-9-yl] acetate.
| Compound Name | [(3S,3aS,6E,9R,10E,12aR)-6,10,12a-trimethyl-1-oxo-3-prop-1-en-2-yl-2,3,3a,4,5,8,9,12-octahydrocyclopenta[11]annulen-9-yl] acetate |
|---|---|
| PubChem CID | 70675884 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(3S,3aS,6E,9R,10E,12aR)-6,10,12a-trimethyl-1-oxo-3-prop-1-en-2-yl-2,3,3a,4,5,8,9,12-octahydrocyclopenta[11]annulen-9-yl] acetate |
| SMILES | C=C(C)[C@H]1CC(=O)[C@]2(C)C/C=C(\C)[C@H](OC(C)=O)C/C=C(\C)CC[C@@H]12 |
| InChI | InChI=1S/C22H32O3/c1-14(2)18-13-21(24)22(6)12-11-16(4)20(25-17(5)23)10-8-15(3)7-9-19(18)22/h8,11,18-20H,1,7,9-10,12-13H2,2-6H3/b15-8+,16-11+/t18-,19+,20-,22-/m1/s1 |
| InChIKey | NXXCCEOEKNJXPD-WLSGCCNPSA-N |
| XLogP | 5.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|