C20H32O — CID 11822345
(2R,5E,9E,11Z)-5,9-dimethyl-12-propan-2-yl-2-prop-1-en-2-yl-1-oxacyclotrideca-5,9,11-triene (PubChem CID 11822345) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (2R,5E,9E,11Z)-5,9-dimethyl-12-propan-2-yl-2-prop-1-en-2-yl-1-oxacyclotrideca-5,9,11-triene.
| Compound Name | (2R,5E,9E,11Z)-5,9-dimethyl-12-propan-2-yl-2-prop-1-en-2-yl-1-oxacyclotrideca-5,9,11-triene |
|---|---|
| PubChem CID | 11822345 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (2R,5E,9E,11Z)-5,9-dimethyl-12-propan-2-yl-2-prop-1-en-2-yl-1-oxacyclotrideca-5,9,11-triene |
| SMILES | C=C(C)[C@H]1CC/C(C)=C/CC/C(C)=C/C=C(/C(C)C)CO1 |
| InChI | InChI=1S/C20H32O/c1-15(2)19-12-10-17(5)8-7-9-18(6)11-13-20(16(3)4)21-14-19/h9-10,12,15,20H,3,7-8,11,13-14H2,1-2,4-6H3/b17-10+,18-9+,19-12+/t20-/m1/s1 |
| InChIKey | IIAYYUNNYDTZDB-JOHPJRNISA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|