C30H52O2Si — CID 11091948
(1R,3S,5S,6S,7R,9Z,11S,13R,16S,17S)-5-[tert-butyl(dimethyl)silyl]oxy-6,10,13-trimethyl-16-propan-2-yltetracyclo[9.7.0.03,7.013,17]octadec-9-en-2-one (PubChem CID 11091948) has the molecular formula C30H52O2Si and a molecular weight of 472.83 g/mol. Its IUPAC name is (1R,3S,5S,6S,7R,9Z,11S,13R,16S,17S)-5-[tert-butyl(dimethyl)silyl]oxy-6,10,13-trimethyl-16-propan-2-yltetracyclo[9.7.0.03,7.013,17]octadec-9-en-2-one.
| Compound Name | (1R,3S,5S,6S,7R,9Z,11S,13R,16S,17S)-5-[tert-butyl(dimethyl)silyl]oxy-6,10,13-trimethyl-16-propan-2-yltetracyclo[9.7.0.03,7.013,17]octadec-9-en-2-one |
|---|---|
| PubChem CID | 11091948 |
| Molecular Formula | C30H52O2Si |
| Molecular Weight | 472.83 g/mol |
| Exact Mass | 472.37 |
| IUPAC Name | (1R,3S,5S,6S,7R,9Z,11S,13R,16S,17S)-5-[tert-butyl(dimethyl)silyl]oxy-6,10,13-trimethyl-16-propan-2-yltetracyclo[9.7.0.03,7.013,17]octadec-9-en-2-one |
| SMILES | C/C1=C/C[C@@H]2[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2C(=O)[C@@H]2C[C@H]3[C@H](C(C)C)CC[C@]3(C)C[C@H]12 |
| InChI | InChI=1S/C30H52O2Si/c1-18(2)21-13-14-30(8)17-25-19(3)11-12-22-20(4)27(32-33(9,10)29(5,6)7)16-24(22)28(31)23(25)15-26(21)30/h11,18,20-27H,12-17H2,1-10H3/b19-11-/t20-,21-,22+,23+,24-,25+,26-,27-,30+/m0/s1 |
| InChIKey | AXZBLLICBMIZMS-XZEIXNHBSA-N |
| XLogP | 8.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.83 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|