C14H22Br2O2 — CID 59026990
(4S)-5-[(2R,6R)-6-(3,3-dibromoprop-2-enyl)-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-1-ol (PubChem CID 59026990) has the molecular formula C14H22Br2O2 and a molecular weight of 382.14 g/mol. Its IUPAC name is (4S)-5-[(2R,6R)-6-(3,3-dibromoprop-2-enyl)-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-1-ol.
| Compound Name | (4S)-5-[(2R,6R)-6-(3,3-dibromoprop-2-enyl)-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 59026990 |
| Molecular Formula | C14H22Br2O2 |
| Molecular Weight | 382.14 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | (4S)-5-[(2R,6R)-6-(3,3-dibromoprop-2-enyl)-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-1-ol |
| SMILES | C[C@@H](CCCO)C[C@@H]1CC=C[C@@H](CC=C(Br)Br)O1 |
| InChI | InChI=1S/C14H22Br2O2/c1-11(4-3-9-17)10-13-6-2-5-12(18-13)7-8-14(15)16/h2,5,8,11-13,17H,3-4,6-7,9-10H2,1H3/t11-,12-,13-/m0/s1 |
| InChIKey | IIBVUUMWRPULIC-AVGNSLFASA-N |
| XLogP | 4.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.14 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|