C20H35BrO2Si — CID 101096078
[(1R,2R)-2-[(2R,5E)-5-(bromomethylidene)oxan-2-yl]-5-propan-2-ylidenecyclopentyl]oxy-tert-butyl-dimethylsilane (PubChem CID 101096078) has the molecular formula C20H35BrO2Si and a molecular weight of 415.49 g/mol. Its IUPAC name is [(1R,2R)-2-[(2R,5E)-5-(bromomethylidene)oxan-2-yl]-5-propan-2-ylidenecyclopentyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R)-2-[(2R,5E)-5-(bromomethylidene)oxan-2-yl]-5-propan-2-ylidenecyclopentyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101096078 |
| Molecular Formula | C20H35BrO2Si |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [(1R,2R)-2-[(2R,5E)-5-(bromomethylidene)oxan-2-yl]-5-propan-2-ylidenecyclopentyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)=C1CC[C@H]([C@H]2CC/C(=C\Br)CO2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H35BrO2Si/c1-14(2)16-9-10-17(18-11-8-15(12-21)13-22-18)19(16)23-24(6,7)20(3,4)5/h12,17-19H,8-11,13H2,1-7H3/b15-12+/t17-,18-,19+/m1/s1 |
| InChIKey | RVTIPWTUHVGBET-YJKLHDBZSA-N |
| XLogP | 6.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|