C21H37BrO2Si — CID 10693888
[(1S,2R,5S)-2-[(2R,5Z)-5-(2-bromoethylidene)oxan-2-yl]-5-prop-1-en-2-ylcyclopentyl]oxy-tert-butyl-dimethylsilane (PubChem CID 10693888) has the molecular formula C21H37BrO2Si and a molecular weight of 429.52 g/mol. Its IUPAC name is [(1S,2R,5S)-2-[(2R,5Z)-5-(2-bromoethylidene)oxan-2-yl]-5-prop-1-en-2-ylcyclopentyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2R,5S)-2-[(2R,5Z)-5-(2-bromoethylidene)oxan-2-yl]-5-prop-1-en-2-ylcyclopentyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10693888 |
| Molecular Formula | C21H37BrO2Si |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [(1S,2R,5S)-2-[(2R,5Z)-5-(2-bromoethylidene)oxan-2-yl]-5-prop-1-en-2-ylcyclopentyl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C(C)[C@@H]1CC[C@H]([C@H]2CC/C(=C/CBr)CO2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H37BrO2Si/c1-15(2)17-9-10-18(19-11-8-16(12-13-22)14-23-19)20(17)24-25(6,7)21(3,4)5/h12,17-20H,1,8-11,13-14H2,2-7H3/b16-12-/t17-,18+,19+,20-/m0/s1 |
| InChIKey | GTGCKKMGNQGAQP-DUYKLVDJSA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|