C21H36OSi2 — CID 71475278
3-[[(1E,5S,7aR)-7a-methyl-1-(2-trimethylsilylethylidene)-3,5,6,7-tetrahydro-2H-inden-5-yl]oxy]prop-1-ynyl-trimethylsilane (PubChem CID 71475278) has the molecular formula C21H36OSi2 and a molecular weight of 360.69 g/mol. Its IUPAC name is 3-[[(1E,5S,7aR)-7a-methyl-1-(2-trimethylsilylethylidene)-3,5,6,7-tetrahydro-2H-inden-5-yl]oxy]prop-1-ynyl-trimethylsilane.
| Compound Name | 3-[[(1E,5S,7aR)-7a-methyl-1-(2-trimethylsilylethylidene)-3,5,6,7-tetrahydro-2H-inden-5-yl]oxy]prop-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 71475278 |
| Molecular Formula | C21H36OSi2 |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 3-[[(1E,5S,7aR)-7a-methyl-1-(2-trimethylsilylethylidene)-3,5,6,7-tetrahydro-2H-inden-5-yl]oxy]prop-1-ynyl-trimethylsilane |
| SMILES | C[C@@]12CC[C@H](OCC#C[Si](C)(C)C)C=C1CC/C2=C\C[Si](C)(C)C |
| InChI | InChI=1S/C21H36OSi2/c1-21-13-11-20(22-14-8-15-23(2,3)4)17-19(21)10-9-18(21)12-16-24(5,6)7/h12,17,20H,9-11,13-14,16H2,1-7H3/b18-12+/t20-,21-/m0/s1 |
| InChIKey | BJAIXSBLCVSELS-AXQVDIEISA-N |
| XLogP | 6.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|