C18H28OSi — CID 71475277
[(2E)-2-[(5S,7aR)-7a-methyl-5-prop-2-ynoxy-3,5,6,7-tetrahydro-2H-inden-1-ylidene]ethyl]-trimethylsilane (PubChem CID 71475277) has the molecular formula C18H28OSi and a molecular weight of 288.51 g/mol. Its IUPAC name is [(2E)-2-[(5S,7aR)-7a-methyl-5-prop-2-ynoxy-3,5,6,7-tetrahydro-2H-inden-1-ylidene]ethyl]-trimethylsilane.
| Compound Name | [(2E)-2-[(5S,7aR)-7a-methyl-5-prop-2-ynoxy-3,5,6,7-tetrahydro-2H-inden-1-ylidene]ethyl]-trimethylsilane |
|---|---|
| PubChem CID | 71475277 |
| Molecular Formula | C18H28OSi |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | [(2E)-2-[(5S,7aR)-7a-methyl-5-prop-2-ynoxy-3,5,6,7-tetrahydro-2H-inden-1-ylidene]ethyl]-trimethylsilane |
| SMILES | C#CCO[C@@H]1C=C2CC/C(=C\C[Si](C)(C)C)[C@]2(C)CC1 |
| InChI | InChI=1S/C18H28OSi/c1-6-12-19-17-9-11-18(2)15(7-8-16(18)14-17)10-13-20(3,4)5/h1,10,14,17H,7-9,11-13H2,2-5H3/b15-10+/t17-,18-/m0/s1 |
| InChIKey | OWWUZBMDGJQKOY-WOVXLNPSSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|