C19H32O2Si — CID 132938706
[(1R,5S,7aR)-7a-methyl-5-prop-2-ynoxy-1,2,3,5,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 132938706) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is [(1R,5S,7aR)-7a-methyl-5-prop-2-ynoxy-1,2,3,5,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,5S,7aR)-7a-methyl-5-prop-2-ynoxy-1,2,3,5,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 132938706 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | [(1R,5S,7aR)-7a-methyl-5-prop-2-ynoxy-1,2,3,5,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C#CCO[C@@H]1C=C2CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@]2(C)CC1 |
| InChI | InChI=1S/C19H32O2Si/c1-8-13-20-16-11-12-19(5)15(14-16)9-10-17(19)21-22(6,7)18(2,3)4/h1,14,16-17H,9-13H2,2-7H3/t16-,17+,19+/m0/s1 |
| InChIKey | XGBUCJKJJHJTHS-YQVWRLOYSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|