C26H44O3Si2 — CID 11812563
tert-butyl-[[8-[tert-butyl(dimethyl)silyl]oxy-3-oxabicyclo[9.2.2]pentadec-1(13)-en-5,9-diyn-11-yl]oxy]-dimethylsilane (PubChem CID 11812563) has the molecular formula C26H44O3Si2 and a molecular weight of 460.81 g/mol. Its IUPAC name is tert-butyl-[[8-[tert-butyl(dimethyl)silyl]oxy-3-oxabicyclo[9.2.2]pentadec-1(13)-en-5,9-diyn-11-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[8-[tert-butyl(dimethyl)silyl]oxy-3-oxabicyclo[9.2.2]pentadec-1(13)-en-5,9-diyn-11-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11812563 |
| Molecular Formula | C26H44O3Si2 |
| Molecular Weight | 460.81 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | tert-butyl-[[8-[tert-butyl(dimethyl)silyl]oxy-3-oxabicyclo[9.2.2]pentadec-1(13)-en-5,9-diyn-11-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1C#CC2(O[Si](C)(C)C(C)(C)C)CC=C(CC2)COCC#CC1 |
| InChI | InChI=1S/C26H44O3Si2/c1-24(2,3)30(7,8)28-23-13-11-12-20-27-21-22-14-17-26(18-15-22,19-16-23)29-31(9,10)25(4,5)6/h14,23H,13,15,17-18,20-21H2,1-10H3 |
| InChIKey | VBNFCEFAUKYOKI-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.81 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|