C29H58O3SiSn — CID 134880485
2-[[(1S,5S,7aS)-7a-methyl-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 134880485) has the molecular formula C29H58O3SiSn and a molecular weight of 601.58 g/mol. Its IUPAC name is 2-[[(1S,5S,7aS)-7a-methyl-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(1S,5S,7aS)-7a-methyl-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 134880485 |
| Molecular Formula | C29H58O3SiSn |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | 2-[[(1S,5S,7aS)-7a-methyl-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)CO[C@@H]1C=C2CC[C@H](OCOCC[Si](C)(C)C)[C@@]2(C)CC1 |
| InChI | InChI=1S/C17H31O3Si.3C4H9.Sn/c1-17-9-8-15(18-2)12-14(17)6-7-16(17)20-13-19-10-11-21(3,4)5;3*1-3-4-2;/h12,15-16H,2,6-11,13H2,1,3-5H3;3*1,3-4H2,2H3;/t15-,16-,17-;;;;/m0..../s1 |
| InChIKey | RVYYDCZFDYJZHV-KAGLKPPMSA-N |
| XLogP | 8.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|