C33H66O3SiSn — CID 162417033
2-[[(1S,5S,7aS)-7a-methyl-4-(2-methylpropyl)-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 162417033) has the molecular formula C33H66O3SiSn and a molecular weight of 657.69 g/mol. Its IUPAC name is 2-[[(1S,5S,7aS)-7a-methyl-4-(2-methylpropyl)-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(1S,5S,7aS)-7a-methyl-4-(2-methylpropyl)-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 162417033 |
| Molecular Formula | C33H66O3SiSn |
| Molecular Weight | 657.69 g/mol |
| Exact Mass | 658.38 |
| IUPAC Name | 2-[[(1S,5S,7aS)-7a-methyl-4-(2-methylpropyl)-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)CO[C@H]1CC[C@@]2(C)C(=C1CC(C)C)CC[C@@H]2OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C21H39O3Si.3C4H9.Sn/c1-16(2)14-17-18-8-9-20(21(18,3)11-10-19(17)22-4)24-15-23-12-13-25(5,6)7;3*1-3-4-2;/h16,19-20H,4,8-15H2,1-3,5-7H3;3*1,3-4H2,2H3;/t19-,20-,21-;;;;/m0..../s1 |
| InChIKey | VYUUUVXPIZSMSL-ADMSPFDOSA-N |
| XLogP | 10.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.69 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|