C19H36O3Si — CID 134880486
(1S,5S,7aS)-7a-methyl-4-propan-2-yl-1-(2-trimethylsilylethoxymethoxy)-1,2,3,5,6,7-hexahydroinden-5-ol (PubChem CID 134880486) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is (1S,5S,7aS)-7a-methyl-4-propan-2-yl-1-(2-trimethylsilylethoxymethoxy)-1,2,3,5,6,7-hexahydroinden-5-ol.
| Compound Name | (1S,5S,7aS)-7a-methyl-4-propan-2-yl-1-(2-trimethylsilylethoxymethoxy)-1,2,3,5,6,7-hexahydroinden-5-ol |
|---|---|
| PubChem CID | 134880486 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (1S,5S,7aS)-7a-methyl-4-propan-2-yl-1-(2-trimethylsilylethoxymethoxy)-1,2,3,5,6,7-hexahydroinden-5-ol |
| SMILES | CC(C)C1=C2CC[C@H](OCOCC[Si](C)(C)C)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C19H36O3Si/c1-14(2)18-15-7-8-17(19(15,3)10-9-16(18)20)22-13-21-11-12-23(4,5)6/h14,16-17,20H,7-13H2,1-6H3/t16-,17-,19-/m0/s1 |
| InChIKey | YWNANPAYHGPQPV-LNLFQRSKSA-N |
| XLogP | 4.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|