C21H40O4Si — CID 134942045
(1S,3aS,4S,5S,7aR)-1-(methoxymethoxy)-3a,5,7a-trimethyl-4-(triethylsilyloxymethyl)-1,2,3,4-tetrahydroinden-5-ol (PubChem CID 134942045) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is (1S,3aS,4S,5S,7aR)-1-(methoxymethoxy)-3a,5,7a-trimethyl-4-(triethylsilyloxymethyl)-1,2,3,4-tetrahydroinden-5-ol.
| Compound Name | (1S,3aS,4S,5S,7aR)-1-(methoxymethoxy)-3a,5,7a-trimethyl-4-(triethylsilyloxymethyl)-1,2,3,4-tetrahydroinden-5-ol |
|---|---|
| PubChem CID | 134942045 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (1S,3aS,4S,5S,7aR)-1-(methoxymethoxy)-3a,5,7a-trimethyl-4-(triethylsilyloxymethyl)-1,2,3,4-tetrahydroinden-5-ol |
| SMILES | CC[Si](CC)(CC)OC[C@H]1[C@@](C)(O)C=C[C@@]2(C)[C@@H](OCOC)CC[C@@]12C |
| InChI | InChI=1S/C21H40O4Si/c1-8-26(9-2,10-3)25-15-17-19(4)12-11-18(24-16-23-7)20(19,5)13-14-21(17,6)22/h13-14,17-18,22H,8-12,15-16H2,1-7H3/t17-,18+,19+,20+,21+/m1/s1 |
| InChIKey | DVRUWXCCUAIDKS-SYAJIYQZSA-N |
| XLogP | 4.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|