C32H64O4SiSn — CID 44521737
[(1S,5S,7aS)-4-(methoxymethoxymethyl)-7a-methyl-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 44521737) has the molecular formula C32H64O4SiSn and a molecular weight of 659.66 g/mol. Its IUPAC name is [(1S,5S,7aS)-4-(methoxymethoxymethyl)-7a-methyl-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,5S,7aS)-4-(methoxymethoxymethyl)-7a-methyl-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 44521737 |
| Molecular Formula | C32H64O4SiSn |
| Molecular Weight | 659.66 g/mol |
| Exact Mass | 660.36 |
| IUPAC Name | [(1S,5S,7aS)-4-(methoxymethoxymethyl)-7a-methyl-5-(tributylstannylmethoxy)-1,2,3,5,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)CO[C@H]1CC[C@@]2(C)C(=C1COCOC)CC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H37O4Si.3C4H9.Sn/c1-19(2,3)25(7,8)24-18-10-9-16-15(13-23-14-21-5)17(22-6)11-12-20(16,18)4;3*1-3-4-2;/h17-18H,6,9-14H2,1-5,7-8H3;3*1,3-4H2,2H3;/t17-,18-,20-;;;;/m0..../s1 |
| InChIKey | MFVQSZJYOCJBRW-PCIMLXTCSA-N |
| XLogP | 9.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.66 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|