C17H31BrO2Si — CID 135049518
[(1S,5S,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,5,6,7-hexahydroinden-5-yl]oxy-(bromomethyl)-dimethylsilane (PubChem CID 135049518) has the molecular formula C17H31BrO2Si and a molecular weight of 375.42 g/mol. Its IUPAC name is [(1S,5S,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,5,6,7-hexahydroinden-5-yl]oxy-(bromomethyl)-dimethylsilane.
| Compound Name | [(1S,5S,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,5,6,7-hexahydroinden-5-yl]oxy-(bromomethyl)-dimethylsilane |
|---|---|
| PubChem CID | 135049518 |
| Molecular Formula | C17H31BrO2Si |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [(1S,5S,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,5,6,7-hexahydroinden-5-yl]oxy-(bromomethyl)-dimethylsilane |
| SMILES | CC(C)(C)O[C@H]1CCC2=C[C@@H](O[Si](C)(C)CBr)CC[C@@]21C |
| InChI | InChI=1S/C17H31BrO2Si/c1-16(2,3)19-15-8-7-13-11-14(9-10-17(13,15)4)20-21(5,6)12-18/h11,14-15H,7-10,12H2,1-6H3/t14-,15-,17-/m0/s1 |
| InChIKey | WVTLFVZJZBVMRX-ZOBUZTSGSA-N |
| XLogP | 5.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|