C19H34O2Si — CID 11034638
tert-butyl-dimethyl-[(2,6,6-trimethyl-3-prop-2-ynoxycyclohexen-1-yl)methoxy]silane (PubChem CID 11034638) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2,6,6-trimethyl-3-prop-2-ynoxycyclohexen-1-yl)methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2,6,6-trimethyl-3-prop-2-ynoxycyclohexen-1-yl)methoxy]silane |
|---|---|
| PubChem CID | 11034638 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl-dimethyl-[(2,6,6-trimethyl-3-prop-2-ynoxycyclohexen-1-yl)methoxy]silane |
| SMILES | C#CCOC1CCC(C)(C)C(CO[Si](C)(C)C(C)(C)C)=C1C |
| InChI | InChI=1S/C19H34O2Si/c1-10-13-20-17-11-12-19(6,7)16(15(17)2)14-21-22(8,9)18(3,4)5/h1,17H,11-14H2,2-9H3 |
| InChIKey | DHGNOTGIPNBTEW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|