C19H32O2Si — CID 66559463
tert-butyl-[(1S,6R)-6-ethenyl-3-methyl-6-(prop-2-ynoxymethyl)cyclohex-2-en-1-yl]oxy-dimethylsilane (PubChem CID 66559463) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is tert-butyl-[(1S,6R)-6-ethenyl-3-methyl-6-(prop-2-ynoxymethyl)cyclohex-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,6R)-6-ethenyl-3-methyl-6-(prop-2-ynoxymethyl)cyclohex-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 66559463 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | tert-butyl-[(1S,6R)-6-ethenyl-3-methyl-6-(prop-2-ynoxymethyl)cyclohex-2-en-1-yl]oxy-dimethylsilane |
| SMILES | C#CCOC[C@]1(C=C)CCC(C)=C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O2Si/c1-9-13-20-15-19(10-2)12-11-16(3)14-17(19)21-22(7,8)18(4,5)6/h1,10,14,17H,2,11-13,15H2,3-8H3/t17-,19-/m0/s1 |
| InChIKey | HKQZERCXHHMARK-HKUYNNGSSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|