C20H38O2Si2 — CID 11233930
4-[(2S,3R,6R)-3,6-dimethyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]but-1-ynyl-trimethylsilane (PubChem CID 11233930) has the molecular formula C20H38O2Si2 and a molecular weight of 366.69 g/mol. Its IUPAC name is 4-[(2S,3R,6R)-3,6-dimethyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]but-1-ynyl-trimethylsilane.
| Compound Name | 4-[(2S,3R,6R)-3,6-dimethyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]but-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 11233930 |
| Molecular Formula | C20H38O2Si2 |
| Molecular Weight | 366.69 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-[(2S,3R,6R)-3,6-dimethyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]but-1-ynyl-trimethylsilane |
| SMILES | CC[Si](CC)(CC)OC1=C[C@@H](C)O[C@@H](CCC#C[Si](C)(C)C)[C@H]1C |
| InChI | InChI=1S/C20H38O2Si2/c1-9-24(10-2,11-3)22-20-16-17(4)21-19(18(20)5)14-12-13-15-23(6,7)8/h16-19H,9-12,14H2,1-8H3/t17-,18-,19+/m1/s1 |
| InChIKey | IACJSUUZFXVPJZ-QRVBRYPASA-N |
| XLogP | 5.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|