C19H38O2Si2 — CID 100957897
tert-butyl-[6-[(Z)-3-methoxy-1-trimethylsilylprop-1-enyl]cyclohexen-1-yl]oxy-dimethylsilane (PubChem CID 100957897) has the molecular formula C19H38O2Si2 and a molecular weight of 354.68 g/mol. Its IUPAC name is tert-butyl-[6-[(Z)-3-methoxy-1-trimethylsilylprop-1-enyl]cyclohexen-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[6-[(Z)-3-methoxy-1-trimethylsilylprop-1-enyl]cyclohexen-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 100957897 |
| Molecular Formula | C19H38O2Si2 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | tert-butyl-[6-[(Z)-3-methoxy-1-trimethylsilylprop-1-enyl]cyclohexen-1-yl]oxy-dimethylsilane |
| SMILES | COC/C=C(/C1CCCC=C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C19H38O2Si2/c1-19(2,3)23(8,9)21-17-13-11-10-12-16(17)18(14-15-20-4)22(5,6)7/h13-14,16H,10-12,15H2,1-9H3/b18-14- |
| InChIKey | DRPHIMRUMMOANE-JXAWBTAJSA-N |
| XLogP | 6.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|