C24H46O3Si — CID 91054384
tert-butyl-[(3S,4S,5R)-8-hept-6-enoxy-3-methoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane (PubChem CID 91054384) has the molecular formula C24H46O3Si and a molecular weight of 410.72 g/mol. Its IUPAC name is tert-butyl-[(3S,4S,5R)-8-hept-6-enoxy-3-methoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S,5R)-8-hept-6-enoxy-3-methoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 91054384 |
| Molecular Formula | C24H46O3Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | tert-butyl-[(3S,4S,5R)-8-hept-6-enoxy-3-methoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane |
| SMILES | C=CCCCCCOCC(C)=C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=C)OC |
| InChI | InChI=1S/C24H46O3Si/c1-11-13-14-15-16-17-26-19-20(3)18-21(4)23(22(12-2)25-8)27-28(9,10)24(5,6)7/h11-12,18,21-23H,1-2,13-17,19H2,3-10H3/t21-,22+,23+/m1/s1 |
| InChIKey | XWWNPMFVOPVWCE-VJBWXMMDSA-N |
| XLogP | 6.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|