C24H44F2O3Si — CID 89395602
tert-butyl-[(3S,4S,5R,6Z)-8-(2,2-difluorohept-6-enoxy)-3-methoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane (PubChem CID 89395602) has the molecular formula C24H44F2O3Si and a molecular weight of 446.70 g/mol. Its IUPAC name is tert-butyl-[(3S,4S,5R,6Z)-8-(2,2-difluorohept-6-enoxy)-3-methoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S,5R,6Z)-8-(2,2-difluorohept-6-enoxy)-3-methoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 89395602 |
| Molecular Formula | C24H44F2O3Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | tert-butyl-[(3S,4S,5R,6Z)-8-(2,2-difluorohept-6-enoxy)-3-methoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane |
| SMILES | C=CCCCC(F)(F)COC/C(C)=C\[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=C)OC |
| InChI | InChI=1S/C24H44F2O3Si/c1-11-13-14-15-24(25,26)18-28-17-19(3)16-20(4)22(21(12-2)27-8)29-30(9,10)23(5,6)7/h11-12,16,20-22H,1-2,13-15,17-18H2,3-10H3/b19-16-/t20-,21+,22+/m1/s1 |
| InChIKey | GLTJRRKQJPZWJY-GYLSOVLRSA-N |
| XLogP | 7.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|